BIOPEP-UWM: Report
| ID | 392 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic 11 S soy glycinin hydrolysate. | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 542.5811 | Monoisotopic mass | 542.2691 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kim M.-R., Kawamura Y., Lee C.-H. | |
| Title | |
| Isolation and Identification of Bitter Peptides of Tryptic Hydrolysate of Soybean 11S Glycinin by Reverse-phase High Performance Liquid Chromatography. J. Food Sci., 68, 8, 2416-2422, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CCC1)CC(C)C)C)CC(=O)N InChI=1S/C23H38N6O9/c1-11(2)9-15(28-19(33)12(3)26-20(34)13(24)10-17(25)30)22(36)29-8-4-5-16(29)21(35)27-14(23(37)38)6-7-18(31)32/h11-16H,4-10,24H2,1-3H3,(H2,25,30)(H,26,34)(H,27,35)(H,28,33)(H,31,32)(H,37,38)/t12-,13-,14-,15-,16-/m0/s1 InChIKey: CVHVYXXEAVBVPW-QXKUPLGCSA-N |
| Database reference: |
| PubChem: ID 71378758 |