BIOPEP-UWM: Report
| ID | 393 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic 11 S soy glycinin hydrolysate. | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 591.5245 | Monoisotopic mass | 591.2128 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kim M.-R., Kawamura Y., Lee C.-H. | |
| Title | |
| Isolation and Identification of Bitter Peptides of Tryptic Hydrolysate of Soybean 11S Glycinin by Reverse-phase High Performance Liquid Chromatography. J. Food Sci., 68, 8, 2416-2422, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)[C@H](O)C)CC(=O)O)CCC(=O)O)CC(=O)N)CC(=O)N InChI=1S/C21H33N7O13/c1-7(29)16(21(40)41)28-20(39)11(6-15(34)35)27-18(37)9(2-3-14(32)33)25-19(38)10(5-13(24)31)26-17(36)8(22)4-12(23)30/h7-11,16,29H,2-6,22H2,1H3,(H2,23,30)(H2,24,31)(H,25,38)(H,26,36)(H,27,37)(H,28,39)(H,32,33)(H,34,35)(H,40,41)/t7-,8+,9+,10+,11+,16+/m1/s1 InChIKey: ASXWCHAXXSWKKK-DGIQMKLGSA-N |
| Database reference: |
| PubChem: ID 91975756 |