BIOPEP-UWM: Report
| ID | 4 |
| Name | bitter amino acid |
| sequence |
| Function: | |||
| (Rcaf) 0.08 | |||
| Number of residues | 1 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 115.1301 | Monoisotopic mass | 115.0631 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: C1C[C@H](NC1)C(=O)O InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1 InChIKey: ONIBWKKTOPOVIA-BYPYZUCNSA-N Annotated as bitter/sweet: Ishibashi N., Kubo T., Chino M., Fukui H., Shinoda I., Kikuchi E., Okai H., Fukui S., 1988, Taste of proline-containing peptides. Agric. Biol. Chem., 52, 95-98; Sweet taste: BIOPEP ID 271 |
| Database reference: |
| ACToR: ID 37159-97-0 BIOPEP database of sensory peptides and amino acids: ID 271 BRENDA: Ligand L-proline ChEBI: ID 17203 ChEMBL: ID CHEMBL54922 ChemSpider: ID 128566 FooDB: ID FDB000570 Human Metabolome Database (HMDB): ID HMDB00162 KEGG: Compound ID C00148 PubChem: ID 145742 ZINC: ID ZINC00895360 |