BIOPEP-UWM: Report
| ID | 410 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami peptide | |||
| Number of residues | 3 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 409.3896 | Monoisotopic mass | 409.1479 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dang Y., Gao X., Ma F., Wu X. | |
| Title | |
| Comparison of umami taste peptides in water-soluble extractions of Jinhua and Parma hams. LWT- Food Science and Technology, 60, 1179-1186, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)CC(=O)O)CCC(=O)O InChI=1S/C18H23N3O8/c19-11(6-7-14(22)23)16(26)20-12(9-15(24)25)17(27)21-13(18(28)29)8-10-4-2-1-3-5-10/h1-5,11-13H,6-9,19H2,(H,20,26)(H,21,27)(H,22,23)(H,24,25)(H,28,29)/t11-,12-,13-/m0/s1 InChIKey: PAQUJCSYVIBPLC-AVGNSLFASA-N Inhibitor of HIV-1 retropepsin (EC 3.4.23.16; MEROPS ID: A02.001) according to the BRENDA database; the HIPdb database, the NIAID database |
| Database reference: |
| BRENDA: Ligand Glu-Asp-Phe ChemSpider: ID 414194 HIPdb: ID HIP14 NIAID: ID 071532 PubChem: ID 471580 SATPdb: ID satpdb29154 |