BIOPEP-UWM: Report
| ID | 412 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami peptide | |||
| Number of residues | 3 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 363.3197 | Monoisotopic mass | 363.1272 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dang Y., Gao X., Ma F., Wu X. | |
| Title | |
| Comparison of umami taste peptides in water-soluble extractions of Jinhua and Parma hams. LWT- Food Science and Technology, 60, 1179-1186, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CCC(=O)O)CO InChI=1S/C13H21N3O9/c14-6(5-17)11(22)15-7(1-3-9(18)19)12(23)16-8(13(24)25)2-4-10(20)21/h6-8,17H,1-5,14H2,(H,15,22)(H,16,23)(H,18,19)(H,20,21)(H,24,25)/t6-,7-,8-/m0/s1 InChIKey: UOLGINIHBRIECN-FXQIFTODSA-N The first reference concerning peptide taste: Noguchi M., Arai S., Yamashita M., Kato H., Fujimaki M., 1975, Isolation and identification of acidic oligopeptides occurring in a flavor potentiating fraction from a fish protein hydrolysate. J. Agric. Food Chem., 23, 49-53 |
| Database reference: |
| EROP-Moscow: ID E01862 |