BIOPEP-UWM: Report
| ID | 417 |
| Name | Umami enhancing peptide |
| sequence |
| Function: | |||
| Umami enhancing peptide | |||
| Number of residues | 11 |
Activity code | ume |
| Activity : | umami enhancing |
|||
| Chemical mass | 1091.0413 | Monoisotopic mass | 1090.4511 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Su G., Cui C., Zheng L., Yang B., Ren J., Zhao M. | |
| Title | |
| Isolation and identification of two novel umami and umami-enhancing peptides from peanut hydrolysate by consecutive chromatography and MALDI-TOF/TOF MS. Food Chemistry, 135, 479-485, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C41H66N14O21/c1-18(48-34(69)20(7-9-30(63)64)51-35(70)23(15-56)49-27(59)13-46-32(67)19(42)6-8-29(61)62)39(74)55-11-3-5-26(55)38(73)53-22(12-31(65)66)33(68)47-14-28(60)50-24(16-57)36(71)54-25(17-58)37(72)52-21(40(75)76)4-2-10-45-41(43)44/h18-26,56-58H,2-17,42H2,1H3,(H,46,67)(H,47,68)(H,48,69)(H,49,59)(H,50,60)(H,51,70)(H,52,72)(H,53,73)(H,54,71)(H,61,62)(H,63,64)(H,65,66)(H,75,76)(H4,43,44,45)/t18-,19-,20-,21-,22-,23-,24-,25-,26+/m0/s1 InChIKey: GNVJVYLYIJBNTA-RCKDXRLBSA-N |
| Database reference: |