BIOPEP-UWM: Report
| ID | 421 |
| Name | Salty taste enhancing peptide |
| sequence |
| Function: | |||
| Salty taste enhancer | |||
| Number of residues | 2 |
Activity code | sen |
| Activity : | salt enhancer |
|||
| Chemical mass | 245.2781 | Monoisotopic mass | 245.1484 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Schindler A., Dunkel A., Stähler F., Backes M., Ley J., Meyerhof W., Hofmann T. | |
| Title | |
| Discovery of salt taste enhancing arginyl dipeptides in protein digests and fermented fish sauces by means of a sensomics approach. Journal of Agricultural and Food Chemistry, 59, 12578-12588, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C9H19N5O3/c1-5(10)7(15)14-6(8(16)17)3-2-4-13-9(11)12/h5-6H,2-4,10H2,1H3,(H,14,15)(H,16,17)(H4,11,12,13)/t5-,6-/m0/s1 InChIKey: SITWEMZOJNKJCH-WDSKDSINSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to the AHTPDB database; the BIOPEP database of bioactive peptides (ID 7742) |
| Database reference: |
| AHTPDB: ID 1699, 3274, 3891, 4704, 5136, 5870, 6110, 6690 BIOPEP database of bioactive peptides: ID 7742 BRENDA: Ligand Ala-Arg ChemSpider: ID 393568 PubChem: ID 446132 SATPdb: ID satpdb15773 SureChEMBL: ID SCHEMBL2490761 ZINC: ID ZINC02579085 |