BIOPEP-UWM: Report
| ID | 424 |
| Name | Salty taste enhancing peptide |
| sequence |
| Function: | |||
| Salty taste enhancer | |||
| Number of residues | 2 |
Activity code | sen |
| Activity : | salt enhancer |
|||
| Chemical mass | 273.3311 | Monoisotopic mass | 273.1796 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Schindler A., Dunkel A., Stähler F., Backes M., Ley J., Meyerhof W., Hofmann T. | |
| Title | |
| Discovery of salt taste enhancing arginyl dipeptides in protein digests and fermented fish sauces by means of a sensomics approach. Journal of Agricultural and Food Chemistry, 59, 12578-12588, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C11H23N5O3/c1-6(2)8(10(18)19)16-9(17)7(12)4-3-5-15-11(13)14/h6-8H,3-5,12H2,1-2H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 InChIKey: DAQIJMOLTMGJLO-YUMQZZPRSA-N Inhibitor of Leucyltransferase (EC 2.3.2.6) according to the BRENDA database Inhibitor of Dipeptidyl-peptidase III (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BRENDA database |
| Database reference: |
| BRENDA: Ligand Arg-Val ChEBI: ID 73823 ChemSpider: ID 5360779 Nikkai: ID J36.191G PubChem: ID 6992654 SureChEMBL: ID SCHEMBL320944 ZINC: ID ZINC01579827 |