BIOPEP-UWM: Report
| ID | 426 |
| Name | Salty taste enhancing peptide |
| sequence |
| Function: | |||
| Salty taste enhancer | |||
| Number of residues | 2 |
Activity code | sen |
| Activity : | salt enhancer |
|||
| Chemical mass | 305.3972 | Monoisotopic mass | 305.1517 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Schindler A., Dunkel A., Stähler F., Backes M., Ley J., Meyerhof W., Hofmann T. | |
| Title | |
| Discovery of salt taste enhancing arginyl dipeptides in protein digests and fermented fish sauces by means of a sensomics approach. Journal of Agricultural and Food Chemistry, 59, 12578-12588, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCSC)C(=O)O InChI=1S/C11H23N5O3S/c1-20-6-4-8(10(18)19)16-9(17)7(12)3-2-5-15-11(13)14/h7-8H,2-6,12H2,1H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 InChIKey: ROWCTNFEMKOIFQ-YUMQZZPRSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP database of bioactive peptides (ID 8887) |
| Database reference: |
| BIOPEP database of bioactive peptides: ID 8887 ChEBI: ID 73817 ChemSpider: ID 5382946 MMsINC: code MMs00484061 PubChem: ID 7019989 SureChEMBL: ID SCHEMBL9189133 ZINC: ID ZINC02560961 |