BIOPEP-UWM: Report
| ID | 43 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.67 | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 278.3459 | Monoisotopic mass | 278.1625 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)[C@H](CC)C)Cc1ccccc1 InChI=1S/C15H22N2O3/c1-3-10(2)13(15(19)20)17-14(18)12(16)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H,17,18)(H,19,20)/t10-,12-,13-/m0/s1 InChIKey: JWBLQDDHSDGEGR-DRZSPHRISA-N Another reference concerning bitterness: Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W., 2013, Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 2592; 5416 ChEBI: ID 74717 ChemSpider: ID 5374132 EROP-Moscow: ID E01601 PubChem: ID 7010565 ZINC: ID ZINC02391057 |