BIOPEP-UWM: Report
| ID | 430 |
| Name | Salty peptide |
| sequence |
| Function: | |||
| Sweet peptide | |||
| Number of residues | 4 |
Activity code | sal |
| Activity : | salty |
|||
| Chemical mass | 546.5731 | Monoisotopic mass | 546.2753 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suh J-Y, Kim H-S, Kim M-C, Kong K-H | |
| Title | |
| Design and evaluation of synthetic peptides corresponding to the sweetness loop of the sweet-tasting protein brazzein. Bulletin of Korean Chemical Society, 35, 11, 3353-3356 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C21H38N8O9/c22-8-2-1-4-12(18(35)29-14(20(37)38)5-3-9-26-21(24)25)28-19(36)13(6-7-15(30)31)27-17(34)11(23)10-16(32)33/h11-14H,1-10,22-23H2,(H,27,34)(H,28,36)(H,29,35)(H,30,31)(H,32,33)(H,37,38)(H4,24,25,26)/t11-,12-,13-,14-/m0/s1 InChIKey: WLSQTGFPIONDSD-XUXIUFHCSA-N Synthetic peptide being the part of sweet protein called brazzein. |
| Database reference: |