BIOPEP-UWM: Report
| ID | 437 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide (source: alphaS1-casein). Q value (i. e. average amount of free energy needed to transfer amino acid chains from ethanol to water) = 8091,8 J / (Mol x Res.). | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 434.5311 | Monoisotopic mass | 434.2634 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lemieux L., Simard R. E. | |
| Title | |
| Bitter flavour in dairy products. II. A review of bitter peptides from caseins: their formation, isolation and identification, structure masking and inhibition. Lait, 72, 335-382, 1992 | |
| Year | Source |
| 1992 | book |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C21H34N6O4/c1-13(2)11-15(22)18(28)26-16(9-6-10-25-21(23)24)19(29)27-17(20(30)31)12-14-7-4-3-5-8-14/h3-5,7-8,13,15-17H,6,9-12,22H2,1-2H3,(H,26,28)(H,27,29)(H,30,31)(H4,23,24,25)/t15-,16-,17-/m0/s1 InChIKey: VKOAHIRLIUESLU-ULQDDVLXSA-N |
| Database reference: |