BIOPEP-UWM: Report
| ID | 447 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide. Q value (i. e. average amount of free energy needed to transfer amino acid chains from ethanol to water) = 9093.0 J / (Mol x Res.). | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 554.5902 | Monoisotopic mass | 554.2368 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lemieux L., Simard R. E. | |
| Title | |
| Bitter flavour in dairy products. II. A review of bitter peptides from caseins: their formation, isolation and identification, structure masking and inhibition. Lait, 72, 335-382, 1992 | |
| Year | Source |
| 1992 | book |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CCC1)Cc1ccc(cc1)O)Cc1ccccc1 InChI=1S/C28H34N4O8/c29-20(15-17-5-2-1-3-6-17)25(36)31-22(16-18-8-10-19(33)11-9-18)27(38)32-14-4-7-23(32)26(37)30-21(28(39)40)12-13-24(34)35/h1-3,5-6,8-11,20-23,33H,4,7,12-16,29H2,(H,30,37)(H,31,36)(H,34,35)(H,39,40)/t20-,21-,22-,23-/m0/s1 InChIKey: RIXJNYBDEMKJJP-MLCQCVOFSA-N Previous reference concerning peptide: Belitz H. D., Sparrer D., 1971, Isolierung lines bit teren peptids aus einem chymotryptischen caseinhydrolysat. Lebensm. Wiss. Technol., 4, 139-144 |
| Database reference: |