BIOPEP-UWM: Report
| ID | 453 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide. Q value (i. e. average amount of free energy needed to transfer amino acid chains from ethanol to water) = 6498.0 J / (Mol x res). | |||
| Number of residues | 12 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1360.5504 | Monoisotopic mass | 1359.7374 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lemieux L., Simard R. E. | |
| Title | |
| Bitter flavour in dairy products. II. A review of bitter peptides from caseins: their formation, isolation and identification, structure masking and inhibition. Lait, 72, 335-382, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CC(C)C)CCC2)CCC1)CC(C)C)Cc1[nH]cnc1)CC(C)C)CC(=O)N)CCC(=O)O)C(C)C)CC(=O)O)[C@H](O)C InChI=1S/C62H101N15O19/c1-29(2)20-37(68-55(88)40(25-46(63)79)70-51(84)36(16-17-47(80)81)67-59(92)50(33(9)10)75-56(89)41(26-48(82)83)72-58(91)49(64)34(11)78)52(85)69-39(24-35-27-65-28-66-35)54(87)73-42(22-31(5)6)60(93)77-19-13-15-45(77)61(94)76-18-12-14-44(76)57(90)71-38(21-30(3)4)53(86)74-43(62(95)96)23-32(7)8/h27-34,36-45,49-50,78H,12-26,64H2,1-11H3,(H2,63,79)(H,65,66)(H,67,92)(H,68,88)(H,69,85)(H,70,84)(H,71,90)(H,72,91)(H,73,87)(H,74,86)(H,75,89)(H,80,81)(H,82,83)(H,95,96)/t34-,36+,37+,38+,39+,40+,41+,42+,43+,44+,45+,49+,50+/m1/s1 InChIKey: USJFOIPHVBTQBB-ZOMAZNNRSA-N Previous reference concerning peptide: Visser S., Slangen C. J., Hup G., 1975, Some bitter peptides from rennet-treated casein. A metod for their purification, utilizing chromatographic separation on silica gel. Neth. Milk Dairy J., 29, 319-334 |
| Database reference: |