BIOPEP-UWM: Report
| ID | 454 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide. Q value (i. e. average amount of free energy needed to transfer amino acid chains from ethanol to water) = 5757.6 J / (Mol x res). | |||
| Number of residues | 9 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 995.1703 | Monoisotopic mass | 994.5793 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lemieux L., Simard R. E. | |
| Title | |
| Bitter flavour in dairy products. II. A review of bitter peptides from caseins: their formation, isolation and identification, structure masking and inhibition. Lait, 72, 335-382, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCC(=O)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)O InChI=1S/C45H78N12O13/c1-23(2)21-29(52-42(66)35(24(3)4)54-38(62)27(11-7-8-18-46)50-39(63)30(22-58)53-37(61)26(47)14-16-33(48)59)43(67)56-19-9-13-32(56)41(65)55-36(25(5)6)44(68)57-20-10-12-31(57)40(64)51-28(45(69)70)15-17-34(49)60/h23-32,35-36,58H,7-22,46-47H2,1-6H3,(H2,48,59)(H2,49,60)(H,50,63)(H,51,64)(H,52,66)(H,53,61)(H,54,62)(H,55,65)(H,69,70)/t26-,27-,28-,29-,30-,31+,32+,35-,36-/m0/s1 InChIKey: CQJVTRGTVRAKTN-POLOHUCZSA-N Previous reference concerning peptide: Monnet V., Le Bars D., Gripon J. C., 1986, Specificity of a cell wall proteinase from Streptococcus lactis NCDO763 towards bovine beta-casein. FEMS Microbiol. Lett., 36, 127-131 |
| Database reference: |