BIOPEP-UWM: Report
| ID | 458 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide. Q value (i. e. average amount of free energy needed to transfer amino acid chains from ethanol to water) = 6705.6 J / (Mol x res). | |||
| Number of residues | 14 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1504.7695 | Monoisotopic mass | 1503.8536 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lemieux L., Simard R. E. | |
| Title | |
| Bitter flavour in dairy products. II. A review of bitter peptides from caseins: their formation, isolation and identification, structure masking and inhibition. Lait, 72, 335-382, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)O InChI=1S/C71H113N19O17/c1-9-41(8)58(70(106)107)86-65(101)51-24-17-33-90(51)69(105)47(35-42-18-11-10-12-19-42)83-62(98)48-21-14-30-87(48)54(93)36-78-60(96)44(20-13-29-77-71(75)76)80-66(102)56(39(4)5)84-63(99)49-22-15-31-88(49)55(94)37-79-61(97)46(34-38(2)3)82-67(103)57(40(6)7)85-64(100)50-23-16-32-89(50)68(104)45(26-28-53(74)92)81-59(95)43(72)25-27-52(73)91/h10-12,18-19,38-41,43-51,56-58H,9,13-17,20-37,72H2,1-8H3,(H2,73,91)(H2,74,92)(H,78,96)(H,79,97)(H,80,102)(H,81,95)(H,82,103)(H,83,98)(H,84,99)(H,85,100)(H,86,101)(H,106,107)(H4,75,76,77)/t41-,43-,44-,45-,46-,47-,48+,49+,50+,51+,56-,57-,58-/m0/s1 InChIKey: XFHABZIJYVDZMO-ZSTFQUSUSA-N Previous reference concerning peptide: Monnet V., Le Bars D., Gripon J. C., 1986, Specificity of a cell wall proteinase from Streptococcus lactis NCDO763 towards bosine beta-casein. FEMS Microbiol. Lett., 36, 127-131 |
| Database reference: |