BIOPEP-UWM: Report
| ID | 464 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide. Q value (i. e. average amount of free energy needed to transfer amino acid chains from ethanol to water) = 8324.5 J / (Mol x res). Rcaf = 2.6 | |||
| Number of residues | 9 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 995.2116 | Monoisotopic mass | 994.5833 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lemieux L., Simard R. E. | |
| Title | |
| Bitter flavour in dairy products. II. A review of bitter peptides from caseins: their formation, isolation and identification, structure masking and inhibition. Lait, 72, 335-382, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N3[C@H](C(=O)O)CCC3)CCC(=O)N)CC(C)C)Cc3ccccc3)CCC2)CCC1)C(C)C)C(C)C)C(C)C InChI=1S/C50H78N10O11/c1-27(2)25-33(42(62)53-32(20-21-38(51)61)47(67)60-24-14-19-37(60)50(70)71)54-43(63)34(26-31-15-10-9-11-16-31)55-44(64)35-17-12-22-58(35)48(68)36-18-13-23-59(36)49(69)41(30(7)8)57-46(66)40(29(5)6)56-45(65)39(52)28(3)4/h9-11,15-16,27-30,32-37,39-41H,12-14,17-26,52H2,1-8H3,(H2,51,61)(H,53,62)(H,54,63)(H,55,64)(H,56,65)(H,57,66)(H,70,71)/t32-,33-,34-,35-,36-,37-,39-,40-,41-/m0/s1 InChIKey: BJGIKIZXAUKMRR-NYMWRVKZSA-N Previous reference concerning peptide: Shinoda I., Fushimi A., Kato H., Okai H., Fukui S., 1985, Bitter taste of synthetic C-terminal tetradecapeptide of bovine beta-casein, H-Pro196-Val-Leu-Gly-Pro-Val-Arg-Gly-Pro-Phe-Pro-Ile-Ile-Val209-OH, and its related peptides. Agric. Biol. Chem., 49, 2587-2596 |
| Database reference: |