BIOPEP-UWM: Report
| ID | 473 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide | |||
| Number of residues | 11 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1351.6077 | Monoisotopic mass | 1350.6660 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Karametsi K., Kokkinidou S., Ronningen I., Peterson D. G. | |
| Title | |
| Identification of bitter peptides in aged Cheddar cheese. J. Agric. Food Chem., 62, 8034−8041, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCSC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C68H94N12O15S/c1-41(2)57(63(89)72-48(29-30-56(82)83)65(91)78-34-13-23-54(78)61(87)75-51(68(94)95)40-43-18-8-5-9-19-43)76-62(88)55-24-15-36-80(55)66(92)49(39-44-25-27-45(81)28-26-44)73-58(84)47(20-10-11-32-69)71-59(85)53-22-14-35-79(53)67(93)50(38-42-16-6-4-7-17-42)74-60(86)52-21-12-33-77(52)64(90)46(70)31-37-96-3/h4-9,16-19,25-28,41,46-55,57,81H,10-15,20-24,29-40,69-70H2,1-3H3,(H,71,85)(H,72,89)(H,73,84)(H,74,86)(H,75,87)(H,76,88)(H,82,83)(H,94,95)/t46-,47-,48-,49-,50-,51-,52-,53-,54-,55-,57-/m0/s1 InChIKey: RTTHUNAUMVOZCA-QZJNSHJSSA-N |
| Database reference: |