BIOPEP-UWM: Report
| ID | 478 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 328.3616 | Monoisotopic mass | 328.1418 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asao M., Iwamura H., Akamatsu M., Fujita T. | |
| Title | |
| Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O InChI: InChI=1S/C18H20N2O4/c19-15(10-12-4-2-1-3-5-12)17(22)20-16(18(23)24)11-13-6-8-14(21)9-7-13/h1-9,15-16,21H,10-11,19H2,(H,20,22)(H,23,24)/t15-,16-/m0/s1 InChIKey: FSXRLASFHBWESK-HOTGVXAUSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides; the CHEMBL database; the PubChem database |
| Database reference: |
| AHTPDB: ID 1136; 1413; 1442; 1446; 1457; 1472; 1810; 1817; 1857; 2654; 2672; 2685; 2775; 2883; 3880; 3913; 4254; 4258; 4731; 4950; 5148; 5587; 5741; 5774; 5808; 6260; 6270; 6469; 6876 BIOPEP-UWM database of bioactive peptides: ID 3556 BRENDA: Ligand Phe-Tyr ChEBI: ID 73637 ChEMBL: ID CHEMBL54572 ChemSpider: ID 449878 EPA DSSTox: ID DTXCID40284746 EROP-Moscow: ID E00283 NIAID: ID 192291 ParaPep: ID 1532; 1560 PubChem: CID 515709 SATPdb: ID satpdb15002 ZINC: ID ZINC02384778 |