BIOPEP-UWM: Report
| ID | 480 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 296.2753 | Monoisotopic mass | 296.1004 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Miyashita Y., Takahashi Y., Takayama C., Sumi K., Nakatsuka. K., Ohkubo T., Abe H., Sasaki S. | |
| Title | |
| Structure-taste correlation of L-aspartyl dipeptides using SIMCA method. J. Med. Chem., 29, 906-912, 1986 | |
| Year | Source |
| 1986 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C13H16N2O6/c14-9(6-11(17)18)12(19)15-10(13(20)21)5-7-1-3-8(16)4-2-7/h1-4,9-10,16H,5-6,14H2,(H,15,19)(H,17,18)(H,20,21)/t9-,10-/m0/s1 InChIKey: NALWOULWGHTVDA-UWVGGRQHSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BindingDB database; the BioPepDB database; the BIOPEP-UWM database of bioactive peptides (ID 9072); the ChEMBL database; the PubChem database Inhibitor of tripeptidyl peptidase 2 (EC 3.4.14.10) (MEROPS ID: S08.090) according to the ChEMBL database; the PubChem database Ion flow regulating peptide according to the BIOPEP-UWM database of bioactive peptides (ID 2749); the EROP-Moscow database |
| Database reference: |
| ACToR: ID 22840-03-5 AHTPDB: ID 1350, 4215, 4954 BindingDB: ID 50049712 BioPepDB: ID biopep00157 BIOPEP-UWM database of bioactive peptides: ID 2749, 9072 Brenda: Ligand Asp-Tyr ChEBI: ID 73455 ChEMBL: ID CHEMBL171132 ChemSpider: ID 134366 EPA CompTox: ID DTXSID20177389 EPA DSSTox: ID DTXCID3099880 EROP-Moscow: ID E01600 J-GLOBAL: ID 200907055017390758 Metabolights: ID MTBLC73455 Nikkaji: ID J861.377J PubChem: CID 152455 SATPdb: ID satpdb22485 SureChEMBL: ID SCHEMBL7935661 ZINC: ID ZINC000002391137 |