BIOPEP-UWM: Report
| ID | 482 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 294.3453 | Monoisotopic mass | 294.1574 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asao M., Iwamura H., Akamatsu M., Fujita T. | |
| Title | |
| Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C15H22N2O4/c1-9(2)7-12(16)14(19)17-13(15(20)21)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8,16H2,1-2H3,(H,17,19)(H,20,21)/t12-,13-/m0/s1 InChIKey=LHSGPCFBGJHPCY-STQMWFEESA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BindingDB database; the BIOPEP-UWM database of bioactive peptids (ID 3381); the BRENDA database; the ChEMBL database; the EROP-Moscow database; the PubChem database Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7872) Inhibitor of Renin (EC 3.4.23.15) (MEROPS ID A01.007) according to the BIOPEP-UWM database of bioactive peptides (ID 9470) |
| Database reference: |
| ACToR: ID 968-21-8 AHTPDB: ID 1096, 1173, 1354, 1358, 1361, 1408, 1976, 2958, 3053, 3055, 3178, 3387, 3520, 3856, 3993, 4099, 4717, 5163, 5546, 5613, 5773, 6174, 6365 BindingDB: ID 50348865 BioPepDB: ID biopep00936 BIOPEP-UWM database of bioactive peptides: ID 3381; 7872; 9470 BRENDA: Ligand Leu-Tyr ChEBI: ID 73591 ChEMBL: ID CHEMBL56099 ChemIDplus: ID 968-21-8 ChemSpider: ID 63589 CTD: ID 968-21-8 ECHA: ID 968-21-8 eChemPortal: ID 968-21-8 EROP-Moscow: ID E01336 J-GLOBAL: ID 200907084889987250 Metabolights: ID MTBLC73591 Nikkaji: ID J80.048A PubChem: CID 70410 SATPdb: ID satpdb19431 SureChEMBL: ID SCHEMBL2474675 ZINC: ID ZINC000001708202 |