BIOPEP-UWM: Report
| ID | 489 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 228.2873 | Monoisotopic mass | 228.1469 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asao M., Iwamura H., Akamatsu M., Fujita T. | |
| Title | |
| Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C10H19N3O4/c1-3-5(2)8(12)9(15)13-6(10(16)17)4-7(11)14/h5-6,8H,3-4,12H2,1-2H3,(H2,11,14)(H,13,15)(H,16,17)/t5-,6-,8-/m0/s1 InChIKey=HZYHBDVRCBDJJV-HAFWLYHUSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8501); the BRENDA database; the EROP-Moscow database; the MBPDB database Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 7581); the ChEMBL database; the EROP-Moscow database; the MBPDB database |
| Database reference: |
| AHTPDB: ID 1501, 3018, 3075, 3220, 3352, 3418, 3500, 3565, 3788, 3862, 3952, 4443, 4494, 4673, 5865, 6567 BindingDB: ID 50348850 BioPepDB: ID biopep00554 BIOPEP-UWM database of bioactive peptides: ID 7581; 8501 BRENDA: Ligand Ile-Pro ChEBI:ID 74076 ChEMBL: ID CHEMBL1807684 ChemSpider: ID 392673 EPA CompTox: ID DTXSID70332168 EPA DSSTox: ID DTXCID70283262 EROP-Moscow: ID E09205 FeptideDB: ID 7581; 8501 HMDB: ID HMDB0011174 J-GLOBAL: ID 200907051126439176 MBPDB: peptide IP Metabolights: ID MTBLC74076 Nikkaji: ID J608.440K PlantPepDB: ID PPepDB_3826 PubChem: CID 444876 SATPdb: ID satpdb19409 SureChEMBL: ID SCHEMBL231857 ZINC: ID ZINC000001591038 |