BIOPEP-UWM: Report
| ID | 49 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.33 | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 506.5920 | Monoisotopic mass | 506.2521 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(=O)O)CCC2)CCC1)Cc1ccccc1)Cc1ccccc1 InChI=1S/C28H34N4O5/c29-21(17-19-9-3-1-4-10-19)25(33)30-22(18-20-11-5-2-6-12-20)26(34)31-15-7-13-23(31)27(35)32-16-8-14-24(32)28(36)37/h1-6,9-12,21-24H,7-8,13-18,29H2,(H,30,33)(H,36,37)/t21-,22-,23-,24-/m0/s1 InChIKey: UCKAFRVNOAGILN-ZJZGAYNASA-N |
| Database reference: |