BIOPEP-UWM: Report
| ID | 498 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 7 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 832.0495 | Monoisotopic mass | 831.4195 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang N., Liu H., Zhou X., Wang W., Fan Y., Liu Y. | |
| Title | |
| Taste and stability characteristics of two key umami peptides from pufferfish (Takifugu obscurus). Food Chem., 371, 131124, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensore peptides amd amino acids SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C33H61N13O8S2/c1-17(2)24(46-26(48)19-8-5-12-38-19)30(52)41-18(3)25(47)42-20(9-6-13-39-32(34)35)27(49)43-21(11-15-56-4)28(50)45-23(16-55)29(51)44-22(31(53)54)10-7-14-40-33(36)37/h17-24,38,55H,5-16H2,1-4H3,(H,41,52)(H,42,47)(H,43,49)(H,44,51)(H,45,50)(H,46,48)(H,53,54)(H4,34,35,39)(H4,36,37,40)/t18-,19-,20-,21-,22-,23-,24-/m0/s1 InChIKey=QDZVFKGBNYWHJW-LQDRYOBXSA-N |
| Database reference: |