BIOPEP-UWM: Report
| ID | 505 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 8 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 940.0079 | Monoisotopic mass | 939.4436 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC(=O)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)NCC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CC3=CC=C(C=C3)O)C(=O)O InChI=1S/C43H61N11O13/c1-23(2)17-30(52-40(64)33-6-4-16-54(33)41(65)28(44)20-36(59)60)38(62)51-29(5-3-15-47-43(45)46)37(61)49-21-34(57)48-22-35(58)50-31(18-24-7-11-26(55)12-8-24)39(63)53-32(42(66)67)19-25-9-13-27(56)14-10-25/h7-14,23,28-33,55-56H,3-6,15-22,44H2,1-2H3,(H,48,57)(H,49,61)(H,50,58)(H,51,62)(H,52,64)(H,53,63)(H,59,60)(H,66,67)(H4,45,46,47)/t28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=OXHOPWHOHMRDRG-FSJACQRISA-N Kokumi peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 513) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 513 |