BIOPEP-UWM: Report
| ID | 507 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 9 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 953.1733 | Monoisotopic mass | 952.5938 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C45H80N10O12/c1-24(2)19-29(47)39(60)52-33(21-26(5)6)42(63)54-34(22-27(7)8)44(65)55-18-12-14-35(55)43(64)48-23-36(56)50-30(15-16-37(57)58)40(61)53-32(20-25(3)4)41(62)49-28(9)38(59)51-31(45(66)67)13-10-11-17-46/h24-35H,10-23,46-47H2,1-9H3,(H,48,64)(H,49,62)(H,50,56)(H,51,59)(H,52,60)(H,53,61)(H,54,63)(H,57,58)(H,66,67)/t28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 InChIKey=BBNVVWRDFOZRPF-DZCXQCEKSA-N Sweet peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 516) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 516 |