BIOPEP-UWM: Report
| ID | 512 |
| Name | Kokumi peptide |
| sequence |
| Function: | |||
| Kokumi taste | |||
| Number of residues | 7 |
Activity code | ko |
| Activity : | kokumi |
|||
| Chemical mass | 850.0176 | Monoisotopic mass | 849.5170 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C38H67N13O9/c1-8-21(6)30(36(58)48-26(37(59)60)10-9-13-44-38(41)42)51-31(53)22(7)46-34(56)27(14-19(2)3)50-33(55)25(11-12-29(40)52)47-35(57)28(15-20(4)5)49-32(54)24(39)16-23-17-43-18-45-23/h17-22,24-28,30H,8-16,39H2,1-7H3,(H2,40,52)(H,43,45)(H,46,56)(H,47,57)(H,48,58)(H,49,54)(H,50,55)(H,51,53)(H,59,60)(H4,41,42,44)/t21-,22-,24-,25-,26-,27-,28-,30-/m0/s1 InChIKey=WZQKCMCDYOLEKK-QIBSVWHASA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 504) Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 511) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 504; 511 |