BIOPEP-UWM: Report
| ID | 515 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 9 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 944.0857 | Monoisotopic mass | 943.5224 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C43H69N13O11/c1-23(2)19-29(52-34(59)21-49-36(60)25(5)44)38(62)53-27(15-16-32(45)57)37(61)54-30(20-26-11-7-6-8-12-26)41(65)56-18-10-14-31(56)39(63)55-35(24(3)4)40(64)50-22-33(58)51-28(42(66)67)13-9-17-48-43(46)47/h6-8,11-12,23-25,27-31,35H,9-10,13-22,44H2,1-5H3,(H2,45,57)(H,49,60)(H,50,64)(H,51,58)(H,52,59)(H,53,62)(H,54,61)(H,55,63)(H,66,67)(H4,46,47,48)/t25-,27-,28-,29-,30-,31-,35-/m0/s1 InChIKey=XZUQAJADLIAOAC-UYSGMIOUSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 506) Kokumi peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 514) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 506; 514 |