BIOPEP-UWM: Report
| ID | 517 |
| Name | Sweet peptide |
| sequence |
| Function: | |||
| Sweet taste | |||
| Number of residues | 10 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 975.9987 | Monoisotopic mass | 975.4396 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C41H61N13O15/c1-20(42)33(61)46-18-29(55)50-25(15-23-9-5-4-6-10-23)35(63)48-21(2)34(62)47-19-30(56)51-26(16-31(57)58)37(65)53-27(17-32(59)60)36(64)49-22(3)39(67)54-14-8-12-28(54)38(66)52-24(40(68)69)11-7-13-45-41(43)44/h4-6,9-10,20-22,24-28H,7-8,11-19,42H2,1-3H3,(H,46,61)(H,47,62)(H,48,63)(H,49,64)(H,50,55)(H,51,56)(H,52,66)(H,53,65)(H,57,58)(H,59,60)(H,68,69)(H4,43,44,45)/t20-,21-,22-,24-,25-,26-,27-,28-/m0/s1 InChIKey=POLHSYYXPBMFNH-WWRBEGNOSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 508) Kokumi peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 518) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 508; 518 |