BIOPEP-UWM: Report
| ID | 519 |
| Name | Sweet peptide |
| sequence |
| Function: | |||
| Sweet taste | |||
| Number of residues | 10 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 1132.1773 | Monoisotopic mass | 1131.5179 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C49H73N13O18/c1-23(40(71)56-30(16-17-36(69)70)41(72)57-31(48(79)80)11-8-18-53-49(51)52)54-45(76)37(24(2)64)61-47(78)39(26(4)66)62-46(77)38(25(3)65)60-43(74)33(19-27-9-6-5-7-10-27)58-44(75)34(22-63)59-42(73)32(55-35(68)21-50)20-28-12-14-29(67)15-13-28/h5-7,9-10,12-15,23-26,30-34,37-39,63-67H,8,11,16-22,50H2,1-4H3,(H,54,76)(H,55,68)(H,56,71)(H,57,72)(H,58,75)(H,59,73)(H,60,74)(H,61,78)(H,62,77)(H,69,70)(H,79,80)(H4,51,52,53)/t23-,24+,25+,26+,30-,31-,32-,33-,34-,37-,38-,39-/m0/s1 InChIKey=MCPOJOZYTDTDAL-MIBYPMPPSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 509) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: (ID 509) |