BIOPEP-UWM: Report
| ID | 520 |
| Name | Sweet peptide |
| sequence |
| Function: | |||
| Sweet taste | |||
| Number of residues | 12 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 1197.3808 | Monoisotopic mass | 1196.6856 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu Z., Zhu Y., Wang W., Zhou X., Chen G., Liu Y. | |
| Title | |
| Seven novel umami peptides from Takifugu rubripes and their taste characteristics. Food Chem., 330, 127204, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C52H92N16O16/c1-13-27(10)41(68-49(81)39(25(6)7)66-37(71)22-59-42(74)28(11)60-44(76)30(53)19-38(72)73)50(82)61-29(12)43(75)58-21-36(70)62-32(17-23(2)3)45(77)64-34(20-35(54)69)47(79)67-40(26(8)9)48(80)65-33(18-24(4)5)46(78)63-31(51(83)84)15-14-16-57-52(55)56/h23-34,39-41H,13-22,53H2,1-12H3,(H2,54,69)(H,58,75)(H,59,74)(H,60,76)(H,61,82)(H,62,70)(H,63,78)(H,64,77)(H,65,80)(H,66,71)(H,67,79)(H,68,81)(H,72,73)(H,83,84)(H4,55,56,57)/t27-,28-,29-,30-,31-,32-,33-,34-,39-,40-,41-/m0/s1 InChIKey=ONEICJWVSVAZBE-IPKGHCNHSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 510) Kokumi peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 521) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 510; 521 |