BIOPEP-UWM: Report
| ID | 53 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.67 | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 278.3459 | Monoisotopic mass | 278.1625 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)[C@H](CC)C InChI=1S/C15H22N2O3/c1-3-10(2)13(16)14(18)17-12(15(19)20)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H,17,18)(H,19,20)/t10-,12-,13-/m0/s1 InChIKey: WMDZARSFSMZOQO-DRZSPHRISA-N Another reference concerning bitterness: Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W., 2013, Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP database of bioactive peptides; the ChEMBL database; the EROP-Moscow database |
| Database reference: |
| AAHTPDB: ID 1448; 1897; 2593; 2674; 2978; 3102; 3230; 3332; 3563; 3797; 3948; 4428; 4503; 4700; 5418; 5420; 6579 BindingDB: ID 50407438 BioPepDB: ID biopep00507 BIOPEP-UWM database of bioactive peptides: ID 7593 BRENDA: Ligand Ile-Phe ChEBI: ID 74075 ChEMBL: ID CHEMBL91330 ChemSpider: ID 5373175 EROP-Moscow: ID E07287 FeptideDB: ID 7593 J-GLOBAL: ID 200907013568908346 Metabolights: ID MTBLC74075 Nikkaji: ID J924.588J PubChem: CID 7009595 SATPdb: ID satpdb23069 SureChEMBL: ID SCHEMBL3512463 ZINC: ID ZINC000002384816 |