BIOPEP-UWM: Report
| ID | 531 |
| Name | Bitterness suppressing peptide |
| sequence |
| Function: | |||
| Bitterness suppressing | |||
| Number of residues | 5 |
Activity code | bis |
| Activity : | bitterness suppressing |
|||
| Chemical mass | 547.6219 | Monoisotopic mass | 547.2303 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z., Wang Y., Zhao W., Li J., Shuian D., Liu J. | |
| Title | |
| Identification of Oncorhynchus mykiss nebulin-derived peptides as bitter taste receptor TAS2R14 blockers by in silico screening and molecular docking. Food Chem., 368, 130839, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C22H37N5O9S/c1-11(2)17(26-19(32)15-5-4-7-27(15)21(34)12(23)10-28)20(33)25-14(9-16(29)30)18(31)24-13(22(35)36)6-8-37-3/h11-15,17,28H,4-10,23H2,1-3H3,(H,24,31)(H,25,33)(H,26,32)(H,29,30)(H,35,36)/t12-,13-,14-,15-,17-/m0/s1 InChIKey=HCJFWUNHSFGQTH-BWJWTDLKSA-N |
| Database reference: |