BIOPEP-UWM: Report
| ID | 532 |
| Name | Bitterness suppressing peptide |
| sequence |
| Function: | |||
| Bitterness suppressing | |||
| Number of residues | 6 |
Activity code | bis |
| Activity : | bitterness suppressing |
|||
| Chemical mass | 650.7657 | Monoisotopic mass | 650.2394 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z., Wang Y., Zhao W., Li J., Shuian D., Liu J. | |
| Title | |
| Identification of Oncorhynchus mykiss nebulin-derived peptides as bitter taste receptor TAS2R14 blockers by in silico screening and molecular docking. Food Chem., 368, 130839, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C25H42N6O10S2/c1-12(2)19(23(38)28-15(9-18(33)34)21(36)27-14(25(40)41)6-8-43-3)30-22(37)17-5-4-7-31(17)24(39)16(10-32)29-20(35)13(26)11-42/h12-17,19,32,42H,4-11,26H2,1-3H3,(H,27,36)(H,28,38)(H,29,35)(H,30,37)(H,33,34)(H,40,41)/t13-,14-,15-,16-,17-,19-/m0/s1 InChIKey=JLYMLJQBNOSTLQ-LAIMCUOGSA-N |
| Database reference: |