BIOPEP-UWM: Report
| ID | 541 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 458.5129 | Monoisotopic mass | 458.2384 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu X., Zhang L., Miao X., Li Y., Liu. Y. | |
| Title | |
| The structure features of umami hexapeptides for the T1R1/T1R3 receptor. Food Chem., 221, 599–605, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C21H30N8O4/c22-15(10-14-11-25-12-27-14)18(30)29-17(9-13-5-2-1-3-6-13)19(31)28-16(20(32)33)7-4-8-26-21(23)24/h1-3,5-6,11-12,15-17H,4,7-10,22H2,(H,25,27)(H,28,31)(H,29,30)(H,32,33)(H4,23,24,26)/t15-,16-,17-/m0/s1 InChIKey=AYUOWUNWZGTNKB-ULQDDVLXSA-N Kokumi peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 540) Astringent peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 542) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 540; 542 ChEBI: ID 157849 Metabolomics Workbench: ID 82517 PubChem: CID 145455928 |