BIOPEP-UWM: Report
| ID | 563 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 649.6942 | Monoisotopic mass | 649.3174 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C28H43N9O9/c1-14(38)22(30)25(43)35-18(12-15-6-8-16(39)9-7-15)23(41)36-19(13-21(29)40)26(44)37-11-3-5-20(37)24(42)34-17(27(45)46)4-2-10-33-28(31)32/h6-9,14,17-20,22,38-39H,2-5,10-13,30H2,1H3,(H2,29,40)(H,34,42)(H,35,43)(H,36,41)(H,45,46)(H4,31,32,33)/t14-,17+,18+,19+,20+,22+/m1/s1 InChIKey=KGHBFYZIJFMXCD-VWVZUHNFSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 562) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 562 |