BIOPEP-UWM: Report
| ID | 567 |
| Name | Sour peptide |
| sequence |
| Function: | |||
| Sour | |||
| Number of residues | 6 |
Activity code | sou |
| Activity : | sour |
|||
| Chemical mass | 830.8427 | Monoisotopic mass | 830.3660 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C35H50N12O12/c36-20(13-18-5-2-1-3-6-18)29(53)43-21(7-4-12-41-35(38)39)30(54)47-25(15-28(51)52)33(57)44-22(9-11-27(49)50)31(55)46-24(14-19-16-40-17-42-19)32(56)45-23(34(58)59)8-10-26(37)48/h1-3,5-6,16-17,20-25H,4,7-15,36H2,(H2,37,48)(H,40,42)(H,43,53)(H,44,57)(H,45,56)(H,46,55)(H,47,54)(H,49,50)(H,51,52)(H,58,59)(H4,38,39,41)/t20-,21-,22-,23-,24-,25-/m0/s1 InChIKey=RCHKSLMRLLDOGK-OOPVGHQCSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 566) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 566 |