BIOPEP-UWM: Report
| ID | 569 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 621.6808 | Monoisotopic mass | 621.3112 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C28H43N7O9/c1-15(36)23(31)26(41)33-19(13-16-7-9-17(37)10-8-16)24(39)34-20(14-22(30)38)27(42)35-12-4-6-21(35)25(40)32-18(28(43)44)5-2-3-11-29/h7-10,15,18-21,23,36-37H,2-6,11-14,29,31H2,1H3,(H2,30,38)(H,32,40)(H,33,41)(H,34,39)(H,43,44)/t15-,18+,19+,20+,21+,23+/m1/s1 InChIKey=FJFJNIOOWSPFDN-GJVPGRKHSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 568) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 569 |