BIOPEP-UWM: Report
| ID | 571 |
| Name | Sour peptide |
| sequence |
| Function: | |||
| Sour | |||
| Number of residues | 6 |
Activity code | sou |
| Activity : | sour |
|||
| Chemical mass | 777.8264 | Monoisotopic mass | 777.3871 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C32H51N13O10/c33-18(8-4-12-39-31(35)36)26(50)45-21(14-17-6-2-1-3-7-17)29(53)43-19(9-5-13-40-32(37)38)28(52)44-20(10-11-23(34)46)27(51)41-16-24(47)42-22(30(54)55)15-25(48)49/h1-3,6-7,18-22H,4-5,8-16,33H2,(H2,34,46)(H,41,51)(H,42,47)(H,43,53)(H,44,52)(H,45,50)(H,48,49)(H,54,55)(H4,35,36,39)(H4,37,38,40)/t18-,19-,20-,21-,22-/m0/s1 InChIKey=IYCWNTYCVRPIHB-YFNVTMOMSA-N Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 570) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 570 |