BIOPEP-UWM: Report
| ID | 572 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 6 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 725.7075 | Monoisotopic mass | 725.2873 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C31H39N11O10/c32-19(9-24(33)43)27(47)40-20(6-16-4-2-1-3-5-16)29(49)42-22(8-18-12-35-15-38-18)30(50)41-21(7-17-11-34-14-37-17)28(48)36-13-25(44)39-23(31(51)52)10-26(45)46/h1-5,11-12,14-15,19-23H,6-10,13,32H2,(H2,33,43)(H,34,37)(H,35,38)(H,36,48)(H,39,44)(H,40,47)(H,41,50)(H,42,49)(H,45,46)(H,51,52)/t19-,20-,21-,22-,23-/m0/s1 InChIKey=QFFJUCIWUYRFLX-VUBDRERZSA-N Sour peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 573) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 573 |