BIOPEP-UWM: Report
| ID | 574 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 611.6051 | Monoisotopic mass | 611.2445 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C27H33N9O8/c28-18(6-15-4-2-1-3-5-15)24(40)35-20(8-17-11-30-14-33-17)26(42)36-19(7-16-10-29-13-32-16)25(41)31-12-22(37)34-21(27(43)44)9-23(38)39/h1-5,10-11,13-14,18-21H,6-9,12,28H2,(H,29,32)(H,30,33)(H,31,41)(H,34,37)(H,35,40)(H,36,42)(H,38,39)(H,43,44)/t18-,19-,20-,21-/m0/s1 InChIKey=XJBDEASOSWNALT-TUFLPTIASA-N Sour peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 575) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 575 |