BIOPEP-UWM: Report
| ID | 578 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 7 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 711.7189 | Monoisotopic mass | 711.3177 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang R., Zhou Z., Dong Y., Xu Y., Ji Z., Liu S., Mao J. | |
| Title | |
| Sensory-guided isolation, identification, and active site calculation of novel umami peptides from ethanol precipitation fractions of fermented grain wine (Huangjiu). Foods, 12, 3398, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C29H45N9O12/c1-13(2)23(37-27(47)22(30)14(3)40)28(48)34-16(8-21(42)43)24(44)32-10-20(41)38-6-4-5-19(38)26(46)36-18(11-39)25(45)35-17(29(49)50)7-15-9-31-12-33-15/h9,12-14,16-19,22-23,39-40H,4-8,10-11,30H2,1-3H3,(H,31,33)(H,32,44)(H,34,48)(H,35,45)(H,36,46)(H,37,47)(H,42,43)(H,49,50)/t14-,16+,17+,18+,19+,22+,23+/m1/s1 InChIKey=GVYYJPVPHBJONX-HPKJNESESA-N Sour peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 579) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 579 |