BIOPEP-UWM: Report
| ID | 584 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 8 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 831.8654 | Monoisotopic mass | 831.3960 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Guo W., Ren K., Long Z., Fu X., Zhang J., Liu M., Chen Y. | |
| Title | |
| Efficient screening and discovery of umami peptides in Douchi enhanced by molecular dynamics simulations. Food Chem. X, 24, 101940, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C34H57N9O15/c1-14(2)13-22(42-28(51)15(3)37-30(53)19(35)7-11-24(46)47)32(55)40-20(9-12-25(48)49)31(54)38-17(5)29(52)43-26(18(6)44)33(56)39-16(4)27(50)41-21(34(57)58)8-10-23(36)45/h14-22,26,44H,7-13,35H2,1-6H3,(H2,36,45)(H,37,53)(H,38,54)(H,39,56)(H,40,55)(H,41,50)(H,42,51)(H,43,52)(H,46,47)(H,48,49)(H,57,58)/t15-,16-,17-,18+,19-,20-,21-,22-,26-/m0/s1 InChIKey=RKHZLYPSYHRQGM-SZJXQUCMSA-N |
| Database reference: |