BIOPEP-UWM: Report
| ID | 59 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.43 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 359.4185 | Monoisotopic mass | 359.1839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C19H25N3O4/c23-17(21-15(19(25)26)12-13-6-2-1-3-7-13)16-9-5-11-22(16)18(24)14-8-4-10-20-14/h1-3,6-7,14-16,20H,4-5,8-12H2,(H,21,23)(H,25,26)/t14-,15-,16-/m0/s1 InChIKey=NAIPAPCKKRCMBL-JYJNAYRXSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ChEBI: ID 162604 ChemSpider: ID 8308601 DFBP: ID DFBPACEI2317; DFBPACEI2446 J-GLOBAL: ID 200907063158029644 Metabolomics Workbench: ID 84949 Nikkaji: ID J1.735.080C PubChem: CID 10133086 SATPdb: ID satpdb14566 SureChEMBL: ID SCHEMBL29484185 UniChem: ID 34695967 Wikidata: ID Q106028093 |