BIOPEP-UWM: Report
| ID | 591 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 12 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 1148.2229 | Monoisotopic mass | 1147.5604 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng H., Li W., Chang Y., Hong J., He Y., Wu F., He Z. | |
| Title | |
| A novel and efficient technique for peptides preparation coupled with enzyme membrane reactor from Lentinus edodes tails and identification of umami peptides by virtual screening. LWT, 230, 118255, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CO)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C49H77N15O17/c1-24(2)38(45(77)61-31(48(80)81)17-27-11-7-6-8-12-27)63-46(78)39(25(3)4)62-42(74)29(13-9-15-53-49(51)52)59-43(75)30(18-37(70)71)60-40(72)26(5)57-35(68)21-56-44(76)33-14-10-16-64(33)47(79)32(23-66)58-36(69)20-54-34(67)19-55-41(73)28(50)22-65/h6-8,11-12,24-26,28-33,38-39,65-66H,9-10,13-23,50H2,1-5H3,(H,54,67)(H,55,73)(H,56,76)(H,57,68)(H,58,69)(H,59,75)(H,60,72)(H,61,77)(H,62,74)(H,63,78)(H,70,71)(H,80,81)(H4,51,52,53)/t26-,28-,29-,30-,31-,32-,33-,38-,39-/m0/s1 InChIKey=OMKGROZCFVTPFS-GMJRUMJKSA-N |
| Database reference: |