BIOPEP-UWM: Report
| ID | 592 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 628.6289 | Monoisotopic mass | 628.2484 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng H., Li W., Chang Y., Hong J., He Y., Wu F., He Z. | |
| Title | |
| A novel and efficient technique for peptides preparation coupled with enzyme membrane reactor from Lentinus edodes tails and identification of umami peptides by virtual screening. LWT, 230, 118255, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C29H36N6O10/c1-15(32-27(42)20(11-16-5-3-2-4-6-16)34-26(41)19(30)13-23(31)37)25(40)33-21(14-24(38)39)28(43)35-22(29(44)45)12-17-7-9-18(36)10-8-17/h2-10,15,19-22,36H,11-14,30H2,1H3,(H2,31,37)(H,32,42)(H,33,40)(H,34,41)(H,35,43)(H,38,39)(H,44,45)/t15-,19-,20-,21-,22-/m0/s1 InChIKey=LPVBKYCKVVYLQP-UUVCCDQISA-N |
| Database reference: |