BIOPEP-UWM: Report
| ID | 593 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami | |||
| Number of residues | 6 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 562.5709 | Monoisotopic mass | 562.2379 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng H., Li W., Chang Y., Hong J., He Y., Wu F., He Z. | |
| Title | |
| A novel and efficient technique for peptides preparation coupled with enzyme membrane reactor from Lentinus edodes tails and identification of umami peptides by virtual screening. LWT, 230, 118255, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C25H34N6O9/c1-14(24(38)31-9-5-8-18(31)25(39)40)29-19(32)12-28-23(37)17(11-21(34)35)30-20(33)13-27-22(36)16(26)10-15-6-3-2-4-7-15/h2-4,6-7,14,16-18H,5,8-13,26H2,1H3,(H,27,36)(H,28,37)(H,29,32)(H,30,33)(H,34,35)(H,39,40)/t14-,16-,17-,18-/m0/s1 InChIKey=GPDCUOHXNDPTMJ-DKIMLUQUSA-N |
| Database reference: |