BIOPEP-UWM: Report
| ID | 596 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 417.4974 | Monoisotopic mass | 417.2256 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hashizume K., Ito T., Nagae Y., Tokiwano T. | |
| Title | |
| Quantitation and sensory properties of three newly identified pyroglutamyl oligopeptides in sake. Biosci. Biotech. Biochem., 83, 357-364, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N1[C@@]([H])(CCC1(=O))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)OCC InChI=1S/C22H31N3O5/c1-4-30-22(29)18(13-15-8-6-5-7-9-15)25-21(28)17(12-14(2)3)24-20(27)16-10-11-19(26)23-16/h5-9,14,16-18H,4,10-13H2,1-3H3,(H,23,26)(H,24,27)(H,25,28)/t16-,17-,18-/m0/s1 InChIKey=OQMJBCHFDXOWCC-BZSNNMDCSA-N {P[4O]} - L-Pyroglutamic acid (ID 110 in the BIOPEP-UWM repository of amino acids and modifications) {!OC2:0} - Ethanol (C-terminal modification) (ID 106 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |