BIOPEP-UWM: Report
| ID | 597 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 600.6617 | Monoisotopic mass | 600.2898 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hashizume K., Ito T., Nagae Y., Tokiwano T. | |
| Title | |
| Quantitation and sensory properties of three newly identified pyroglutamyl oligopeptides in sake. Biosci. Biotech. Biochem., 83, 357-364, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N1[C@@]([H])(CCC1(=O))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C29H40N6O8/c1-16(2)13-19(32-25(38)18-10-11-24(37)31-18)26(39)33-20(14-17-7-4-3-5-8-17)27(40)34-21(15-23(30)36)28(41)35-12-6-9-22(35)29(42)43/h3-5,7-8,16,18-22H,6,9-15H2,1-2H3,(H2,30,36)(H,31,37)(H,32,38)(H,33,39)(H,34,40)(H,42,43)/t18-,19-,20-,21-,22-/m0/s1 InChIKey=NUPQSIDCNDIHBJ-YFNVTMOMSA-N {P[4O]} - L-Pyroglutamic acid (ID 110 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |