BIOPEP-UWM: Report
| ID | 6 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.5 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 309.3599 | Monoisotopic mass | 309.1683 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: C1C[C@@H](C(=O)N2CCC[C@H]2C(=O)N2CCC[C@H]2C(=O)O)NC1 InChI=1S/C15H23N3O4/c19-13(10-4-1-7-16-10)17-8-2-5-11(17)14(20)18-9-3-6-12(18)15(21)22/h10-12,16H,1-9H2,(H,21,22)/t10-,11-,12-/m0/s1 InChIKey: SBVPYBFMIGDIDX-SRVKXCTJSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 9172) Inhibitor of Renin (EC 3.4.23.15) (MEROPS ID: A01.007) according to the PubChem database |
| Database reference: |
| AHTPDB: ID 4572; 4848; 5486 BioPepDB: ID biopep01082 BIOPEP-UWM database of bioactive peptides: ID 9172 ChEBI: ID 73647 ChemSpider: ID 388670 KEGG: ID C01843 PubChem: CID 439587 SATPdb: ID satpdb11296 ZINC: ID ZINC04095727 |